C18H20ClF2NO2 — CID 69290801
2-(2,4-difluorophenyl)-1-morpholin-2-yl-1-phenylethanol;hydrochloride (PubChem CID 69290801) has the molecular formula C18H20ClF2NO2 and a molecular weight of 355.81 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-morpholin-2-yl-1-phenylethanol;hydrochloride.
| Compound Name | 2-(2,4-difluorophenyl)-1-morpholin-2-yl-1-phenylethanol;hydrochloride |
|---|---|
| PubChem CID | 69290801 |
| Molecular Formula | C18H20ClF2NO2 |
| Molecular Weight | 355.81 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-morpholin-2-yl-1-phenylethanol;hydrochloride |
| SMILES | Cl.OC(Cc1ccc(F)cc1F)(c1ccccc1)C1CNCCO1 |
| InChI | InChI=1S/C18H19F2NO2.ClH/c19-15-7-6-13(16(20)10-15)11-18(22,14-4-2-1-3-5-14)17-12-21-8-9-23-17;/h1-7,10,17,21-22H,8-9,11-12H2;1H |
| InChIKey | BMKLWMGZAQEVDD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |