C19H22FNO2 — CID 69290825
4-fluoro-2-(2-morpholin-2-yl-2-phenylpropyl)phenol (PubChem CID 69290825) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-fluoro-2-(2-morpholin-2-yl-2-phenylpropyl)phenol.
| Compound Name | 4-fluoro-2-(2-morpholin-2-yl-2-phenylpropyl)phenol |
|---|---|
| PubChem CID | 69290825 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-fluoro-2-(2-morpholin-2-yl-2-phenylpropyl)phenol |
| SMILES | CC(Cc1cc(F)ccc1O)(c1ccccc1)C1CNCCO1 |
| InChI | InChI=1S/C19H22FNO2/c1-19(15-5-3-2-4-6-15,18-13-21-9-10-23-18)12-14-11-16(20)7-8-17(14)22/h2-8,11,18,21-22H,9-10,12-13H2,1H3 |
| InChIKey | WHVIZNIFIULFEX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |