C13H12F3N2NaO2S — CID 174634412
sodium;N-phenyl-4-(trifluoromethyl)-1,3-thiazol-2-amine;propanoic acid (PubChem CID 174634412) has the molecular formula C13H12F3N2NaO2S and a molecular weight of 340.30 g/mol. Its IUPAC name is sodium;N-phenyl-4-(trifluoromethyl)-1,3-thiazol-2-amine;propanoic acid.
| Compound Name | sodium;N-phenyl-4-(trifluoromethyl)-1,3-thiazol-2-amine;propanoic acid |
|---|---|
| PubChem CID | 174634412 |
| Molecular Formula | C13H12F3N2NaO2S |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | sodium;N-phenyl-4-(trifluoromethyl)-1,3-thiazol-2-amine;propanoic acid |
| SMILES | CCC(=O)O.FC(F)(F)c1csc(Nc2cc[c-]cc2)n1.[Na+] |
| InChI | InChI=1S/C10H6F3N2S.C3H6O2.Na/c11-10(12,13)8-6-16-9(15-8)14-7-4-2-1-3-5-7;1-2-3(4)5;/h2-6H,(H,14,15);2H2,1H3,(H,4,5);/q-1;;+1 |
| InChIKey | IMFYUVCAQNYBIB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|