C25H34ClN5O3 — CID 174635743
1-(4-chlorobutanoyl)-6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-2H-quinoline-2-carbaldehyde (PubChem CID 174635743) has the molecular formula C25H34ClN5O3 and a molecular weight of 488.03 g/mol. Its IUPAC name is 1-(4-chlorobutanoyl)-6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-2H-quinoline-2-carbaldehyde.
| Compound Name | 1-(4-chlorobutanoyl)-6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-2H-quinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 174635743 |
| Molecular Formula | C25H34ClN5O3 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 1-(4-chlorobutanoyl)-6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-2H-quinoline-2-carbaldehyde |
| SMILES | O=CC1CCc2cc(OCCCCc3nnnn3C3CCCCC3)ccc2N1C(=O)CCCCl |
| InChI | InChI=1S/C25H34ClN5O3/c26-15-6-10-25(33)30-21(18-32)12-11-19-17-22(13-14-23(19)30)34-16-5-4-9-24-27-28-29-31(24)20-7-2-1-3-8-20/h13-14,17-18,20-21H,1-12,15-16H2 |
| InChIKey | AWOKZAOAMWJIHC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|