C15H12ClNO6 — CID 174636744
dimethyl 6-chloro-4-hydroxy-2-oxo-1-pyridin-3-ylcyclohexa-3,5-diene-1,3-dicarboxylate (PubChem CID 174636744) has the molecular formula C15H12ClNO6 and a molecular weight of 337.72 g/mol. Its IUPAC name is dimethyl 6-chloro-4-hydroxy-2-oxo-1-pyridin-3-ylcyclohexa-3,5-diene-1,3-dicarboxylate.
| Compound Name | dimethyl 6-chloro-4-hydroxy-2-oxo-1-pyridin-3-ylcyclohexa-3,5-diene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 174636744 |
| Molecular Formula | C15H12ClNO6 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | dimethyl 6-chloro-4-hydroxy-2-oxo-1-pyridin-3-ylcyclohexa-3,5-diene-1,3-dicarboxylate |
| SMILES | COC(=O)C1=C(O)C=C(Cl)C(C(=O)OC)(c2cccnc2)C1=O |
| InChI | InChI=1S/C15H12ClNO6/c1-22-13(20)11-9(18)6-10(16)15(12(11)19,14(21)23-2)8-4-3-5-17-7-8/h3-7,18H,1-2H3 |
| InChIKey | SLWSJIVCMFJHDT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|