C12H12N2O3 — CID 174638559
[3-(4-methylphenyl)-1,2-oxazol-5-yl] N-methylcarbamate (PubChem CID 174638559) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is [3-(4-methylphenyl)-1,2-oxazol-5-yl] N-methylcarbamate.
| Compound Name | [3-(4-methylphenyl)-1,2-oxazol-5-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 174638559 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | [3-(4-methylphenyl)-1,2-oxazol-5-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(-c2ccc(C)cc2)no1 |
| InChI | InChI=1S/C12H12N2O3/c1-8-3-5-9(6-4-8)10-7-11(17-14-10)16-12(15)13-2/h3-7H,1-2H3,(H,13,15) |
| InChIKey | JHIILIRWVDTVDJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |