About N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine
N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine (PubChem CID 174639356) has the molecular formula C10H26N2Si
and a molecular weight of 202.42 g/mol. Its IUPAC name is N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine.
Molecular Properties
| Compound Name | N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine |
| PubChem CID | 174639356 |
| Molecular Formula | C10H26N2Si |
| Molecular Weight | 202.42 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine |
| SMILES | C=C[SiH2]N(CC)CC.CCNCC |
| InChI | InChI=1S/C6H15NSi.C4H11N/c1-4-7(5-2)8-6-3;1-3-5-4-2/h6H,3-5,8H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | UIOJASGYDCLKPB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine?
The IUPAC name of N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine (CID 174639356) is N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine.
What is the SMILES notation for N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine?
The canonical SMILES for N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine is C=C[SiH2]N(CC)CC.CCNCC.
What is the InChIKey of N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine?
The InChIKey is UIOJASGYDCLKPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NSi.C4H11N/c1-4-7(5-2)8-6-3;1-3-5-4-2/h6H,3-5,8H2,1-2H3;5H,3-4H2,1-2H3.
What are the key properties of N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine?
N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine has a molecular weight of 202.42 g/mol, XLogP of 1.17, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenylsilyl-N-ethylethanamine;N-ethylethanamine is sourced from PubChem (CID 174639356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).