C13H18N2O3 — CID 174640734
(4R)-4-amino-1-(2,6-dimethoxyphenyl)-2-iminopentan-1-one (PubChem CID 174640734) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (4R)-4-amino-1-(2,6-dimethoxyphenyl)-2-iminopentan-1-one.
| Compound Name | (4R)-4-amino-1-(2,6-dimethoxyphenyl)-2-iminopentan-1-one |
|---|---|
| PubChem CID | 174640734 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (4R)-4-amino-1-(2,6-dimethoxyphenyl)-2-iminopentan-1-one |
| SMILES | [H]/N=C(\C[C@@H](C)N)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C13H18N2O3/c1-8(14)7-9(15)13(16)12-10(17-2)5-4-6-11(12)18-3/h4-6,8,15H,7,14H2,1-3H3/b15-9+/t8-/m1/s1 |
| InChIKey | IZIBOQFNXNZMON-CCMDUDBRSA-N |
| XLogP | 1.64 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|