C19H22N8O3 — CID 174641025
2,4-bis[2-[(3-aminopyrazol-1-yl)methyl]-1,3-oxazol-4-yl]pentan-3-one (PubChem CID 174641025) has the molecular formula C19H22N8O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2,4-bis[2-[(3-aminopyrazol-1-yl)methyl]-1,3-oxazol-4-yl]pentan-3-one.
| Compound Name | 2,4-bis[2-[(3-aminopyrazol-1-yl)methyl]-1,3-oxazol-4-yl]pentan-3-one |
|---|---|
| PubChem CID | 174641025 |
| Molecular Formula | C19H22N8O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2,4-bis[2-[(3-aminopyrazol-1-yl)methyl]-1,3-oxazol-4-yl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1coc(Cn2ccc(N)n2)n1)c1coc(Cn2ccc(N)n2)n1 |
| InChI | InChI=1S/C19H22N8O3/c1-11(13-9-29-17(22-13)7-26-5-3-15(20)24-26)19(28)12(2)14-10-30-18(23-14)8-27-6-4-16(21)25-27/h3-6,9-12H,7-8H2,1-2H3,(H2,20,24)(H2,21,25) |
| InChIKey | JRIUCHFMDVJQOX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 156.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |