C13H16N2O5 — CID 174628116
2,4-bis[2-(hydroxymethyl)-1,3-oxazol-4-yl]pentan-3-one (PubChem CID 174628116) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2,4-bis[2-(hydroxymethyl)-1,3-oxazol-4-yl]pentan-3-one.
| Compound Name | 2,4-bis[2-(hydroxymethyl)-1,3-oxazol-4-yl]pentan-3-one |
|---|---|
| PubChem CID | 174628116 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2,4-bis[2-(hydroxymethyl)-1,3-oxazol-4-yl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1coc(CO)n1)c1coc(CO)n1 |
| InChI | InChI=1S/C13H16N2O5/c1-7(9-5-19-11(3-16)14-9)13(18)8(2)10-6-20-12(4-17)15-10/h5-8,16-17H,3-4H2,1-2H3 |
| InChIKey | SILZOZSPZUQZCZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |