C10H9N3O3 — CID 123622398
2-[(3-acetylpyrazol-1-yl)methyl]-1,3-oxazole-4-carbaldehyde (PubChem CID 123622398) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-[(3-acetylpyrazol-1-yl)methyl]-1,3-oxazole-4-carbaldehyde.
| Compound Name | 2-[(3-acetylpyrazol-1-yl)methyl]-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 123622398 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-[(3-acetylpyrazol-1-yl)methyl]-1,3-oxazole-4-carbaldehyde |
| SMILES | CC(=O)c1ccn(Cc2nc(C=O)co2)n1 |
| InChI | InChI=1S/C10H9N3O3/c1-7(15)9-2-3-13(12-9)4-10-11-8(5-14)6-16-10/h2-3,5-6H,4H2,1H3 |
| InChIKey | PYONFVTWYXTSSH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|