C10H15IN2 — CID 174643318
1,1-diethyl-2-(4-iodophenyl)hydrazine (PubChem CID 174643318) has the molecular formula C10H15IN2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 1,1-diethyl-2-(4-iodophenyl)hydrazine.
| Compound Name | 1,1-diethyl-2-(4-iodophenyl)hydrazine |
|---|---|
| PubChem CID | 174643318 |
| Molecular Formula | C10H15IN2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1,1-diethyl-2-(4-iodophenyl)hydrazine |
| SMILES | CCN(CC)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C10H15IN2/c1-3-13(4-2)12-10-7-5-9(11)6-8-10/h5-8,12H,3-4H2,1-2H3 |
| InChIKey | BZVHMCCFJCIGTC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|