2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid

C12H11NO4 — CID 174643664

IUPAC2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid
SMILESO=C(O)Cc1ncoc1-c1cccc(CO)c1
InChIInChI=1S/C12H11NO4/c14-6-8-2-1-3-9(4-8)12-10(5-11(15)16)13-7-17-12/h1-4,7,14H,5-6H2,(H,15,16)
InChIKeyQBFBUGYJGHPLKN-UHFFFAOYSA-N
MW233.22 g/mol
LogP1.46
Rot. Bonds4

About 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid

2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid (PubChem CID 174643664) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid
PubChem CID174643664
Molecular FormulaC12H11NO4
Molecular Weight233.22 g/mol
Exact Mass233.07
IUPAC Name2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid
SMILESO=C(O)Cc1ncoc1-c1cccc(CO)c1
InChIInChI=1S/C12H11NO4/c14-6-8-2-1-3-9(4-8)12-10(5-11(15)16)13-7-17-12/h1-4,7,14H,5-6H2,(H,15,16)
InChIKeyQBFBUGYJGHPLKN-UHFFFAOYSA-N
XLogP1.46
TPSA83.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.22
LogP ≤ 51.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid (CID 174643664) is 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid is O=C(O)Cc1ncoc1-c1cccc(CO)c1.
What is the InChIKey of 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid?
The InChIKey is QBFBUGYJGHPLKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c14-6-8-2-1-3-9(4-8)12-10(5-11(15)16)13-7-17-12/h1-4,7,14H,5-6H2,(H,15,16).
What are the key properties of 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid?
2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid has a molecular weight of 233.22 g/mol, XLogP of 1.46, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[3-(hydroxymethyl)phenyl]-1,3-oxazol-4-yl]acetic acid is sourced from PubChem (CID 174643664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).