2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid

C12H8N2O3 — CID 22282481

IUPAC2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid
SMILESN#Cc1cccc(-c2ocnc2CC(=O)O)c1
InChIInChI=1S/C12H8N2O3/c13-6-8-2-1-3-9(4-8)12-10(5-11(15)16)14-7-17-12/h1-4,7H,5H2,(H,15,16)
InChIKeyWUZQFBOBDJALJG-UHFFFAOYSA-N
MW228.21 g/mol
LogP1.84
Rot. Bonds3

About 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid

2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 22282481) has the molecular formula C12H8N2O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid
PubChem CID22282481
Molecular FormulaC12H8N2O3
Molecular Weight228.21 g/mol
Exact Mass228.05
IUPAC Name2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid
SMILESN#Cc1cccc(-c2ocnc2CC(=O)O)c1
InChIInChI=1S/C12H8N2O3/c13-6-8-2-1-3-9(4-8)12-10(5-11(15)16)14-7-17-12/h1-4,7H,5H2,(H,15,16)
InChIKeyWUZQFBOBDJALJG-UHFFFAOYSA-N
XLogP1.84
TPSA87.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.21
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid (CID 22282481) is 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid is N#Cc1cccc(-c2ocnc2CC(=O)O)c1.
What is the InChIKey of 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid?
The InChIKey is WUZQFBOBDJALJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O3/c13-6-8-2-1-3-9(4-8)12-10(5-11(15)16)14-7-17-12/h1-4,7H,5H2,(H,15,16).
What are the key properties of 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid?
2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid has a molecular weight of 228.21 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3-cyanophenyl)-1,3-oxazol-4-yl]acetic acid is sourced from PubChem (CID 22282481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).