About 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine
1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine (PubChem CID 174643768) has the molecular formula C13H34N2O2Si2
and a molecular weight of 306.60 g/mol. Its IUPAC name is 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine.
Molecular Properties
| Compound Name | 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine |
| PubChem CID | 174643768 |
| Molecular Formula | C13H34N2O2Si2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine |
| SMILES | CCO[Si](C)(OCC)C(N)CC.N[SiH]1CCCCC1 |
| InChI | InChI=1S/C8H21NO2Si.C5H13NSi/c1-5-8(9)12(4,10-6-2)11-7-3;6-7-4-2-1-3-5-7/h8H,5-7,9H2,1-4H3;7H,1-6H2 |
| InChIKey | ONIJPDLJFRJLKH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine?
The IUPAC name of 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine (CID 174643768) is 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine.
What is the SMILES notation for 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine?
The canonical SMILES for 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine is CCO[Si](C)(OCC)C(N)CC.N[SiH]1CCCCC1.
What is the InChIKey of 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine?
The InChIKey is ONIJPDLJFRJLKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21NO2Si.C5H13NSi/c1-5-8(9)12(4,10-6-2)11-7-3;6-7-4-2-1-3-5-7/h8H,5-7,9H2,1-4H3;7H,1-6H2.
What are the key properties of 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine?
1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine has a molecular weight of 306.60 g/mol, XLogP of 2.26, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[diethoxy(methyl)silyl]propan-1-amine;silinan-1-amine is sourced from PubChem (CID 174643768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).