C27H38Cl2N6O — CID 174643896
1,5-diamino-2,4-bis[4-(2-chloroanilino)piperidin-1-yl]pentan-3-one (PubChem CID 174643896) has the molecular formula C27H38Cl2N6O and a molecular weight of 533.55 g/mol. Its IUPAC name is 1,5-diamino-2,4-bis[4-(2-chloroanilino)piperidin-1-yl]pentan-3-one.
| Compound Name | 1,5-diamino-2,4-bis[4-(2-chloroanilino)piperidin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 174643896 |
| Molecular Formula | C27H38Cl2N6O |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 1,5-diamino-2,4-bis[4-(2-chloroanilino)piperidin-1-yl]pentan-3-one |
| SMILES | NCC(C(=O)C(CN)N1CCC(Nc2ccccc2Cl)CC1)N1CCC(Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C27H38Cl2N6O/c28-21-5-1-3-7-23(21)32-19-9-13-34(14-10-19)25(17-30)27(36)26(18-31)35-15-11-20(12-16-35)33-24-8-4-2-6-22(24)29/h1-8,19-20,25-26,32-33H,9-18,30-31H2 |
| InChIKey | ZGNHMJUXROXBAH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |