C31H48O5 — CID 174644898
dioctyl benzene-1,2-dicarboxylate;furan;prop-1-ene (PubChem CID 174644898) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is dioctyl benzene-1,2-dicarboxylate;furan;prop-1-ene.
| Compound Name | dioctyl benzene-1,2-dicarboxylate;furan;prop-1-ene |
|---|---|
| PubChem CID | 174644898 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | dioctyl benzene-1,2-dicarboxylate;furan;prop-1-ene |
| SMILES | C=CC.CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.c1ccoc1 |
| InChI | InChI=1S/C24H38O4.C4H4O.C3H6/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;1-2-4-5-3-1;1-3-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;1-4H;3H,1H2,2H3 |
| InChIKey | RSFDQTXNRJMZEB-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|