C28H42MnO5 — CID 174823281
dioctyl benzene-1,2-dicarboxylate;furan;manganese (PubChem CID 174823281) has the molecular formula C28H42MnO5 and a molecular weight of 513.58 g/mol. Its IUPAC name is dioctyl benzene-1,2-dicarboxylate;furan;manganese.
| Compound Name | dioctyl benzene-1,2-dicarboxylate;furan;manganese |
|---|---|
| PubChem CID | 174823281 |
| Molecular Formula | C28H42MnO5 |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | dioctyl benzene-1,2-dicarboxylate;furan;manganese |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.[Mn].c1ccoc1 |
| InChI | InChI=1S/C24H38O4.C4H4O.Mn/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;1-2-4-5-3-1;/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;1-4H; |
| InChIKey | VELIMKLBYGYCCB-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|