C10H14N5O9P — CID 174646959
(2-amino-6-oxo-1H-purin-9-yl) [(2S,4S,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] hydrogen phosphate (PubChem CID 174646959) has the molecular formula C10H14N5O9P and a molecular weight of 379.22 g/mol. Its IUPAC name is (2-amino-6-oxo-1H-purin-9-yl) [(2S,4S,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] hydrogen phosphate.
| Compound Name | (2-amino-6-oxo-1H-purin-9-yl) [(2S,4S,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 174646959 |
| Molecular Formula | C10H14N5O9P |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | (2-amino-6-oxo-1H-purin-9-yl) [(2S,4S,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2OP(=O)(O)O[C@]2(O)C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N5O9P/c11-9-13-7-6(8(18)14-9)12-3-15(7)24-25(20,21)23-10(19)1-4(17)5(2-16)22-10/h3-5,16-17,19H,1-2H2,(H,20,21)(H3,11,13,14,18)/t4-,5+,10-/m0/s1 |
| InChIKey | HDXMUHNZELROBZ-LYAQYDMKSA-N |
| XLogP | -2.96 |
| TPSA | 215.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|