About (2-fluoro-2-iodoacetyl) butanoate
(2-fluoro-2-iodoacetyl) butanoate (PubChem CID 174647120) has the molecular formula C6H8FIO3
and a molecular weight of 274.03 g/mol. Its IUPAC name is (2-fluoro-2-iodoacetyl) butanoate.
Molecular Properties
| Compound Name | (2-fluoro-2-iodoacetyl) butanoate |
| PubChem CID | 174647120 |
| Molecular Formula | C6H8FIO3 |
| Molecular Weight | 274.03 g/mol |
| Exact Mass | 273.95 |
| IUPAC Name | (2-fluoro-2-iodoacetyl) butanoate |
| SMILES | CCCC(=O)OC(=O)C(F)I |
| InChI | InChI=1S/C6H8FIO3/c1-2-3-4(9)11-6(10)5(7)8/h5H,2-3H2,1H3 |
| InChIKey | JDNRWSNIBXTLPG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.03 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-fluoro-2-iodoacetyl) butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-2-iodoacetyl) butanoate?
The IUPAC name of (2-fluoro-2-iodoacetyl) butanoate (CID 174647120) is (2-fluoro-2-iodoacetyl) butanoate.
What is the SMILES notation for (2-fluoro-2-iodoacetyl) butanoate?
The canonical SMILES for (2-fluoro-2-iodoacetyl) butanoate is CCCC(=O)OC(=O)C(F)I.
What is the InChIKey of (2-fluoro-2-iodoacetyl) butanoate?
The InChIKey is JDNRWSNIBXTLPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FIO3/c1-2-3-4(9)11-6(10)5(7)8/h5H,2-3H2,1H3.
What are the key properties of (2-fluoro-2-iodoacetyl) butanoate?
(2-fluoro-2-iodoacetyl) butanoate has a molecular weight of 274.03 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-2-iodoacetyl) butanoate is sourced from PubChem (CID 174647120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).