About 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate
1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate (PubChem CID 174647558) has the molecular formula C21H20O6
and a molecular weight of 368.38 g/mol. Its IUPAC name is 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate.
Molecular Properties
| Compound Name | 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate |
| PubChem CID | 174647558 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate |
| SMILES | CC(=O)C(C(=O)Oc1ccccc1OCc1ccccc1)C(=O)OC1CC1 |
| InChI | InChI=1S/C21H20O6/c1-14(22)19(20(23)26-16-11-12-16)21(24)27-18-10-6-5-9-17(18)25-13-15-7-3-2-4-8-15/h2-10,16,19H,11-13H2,1H3 |
| InChIKey | NEDODVATMXPRIJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate?
The IUPAC name of 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate (CID 174647558) is 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate.
What is the SMILES notation for 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate?
The canonical SMILES for 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate is CC(=O)C(C(=O)Oc1ccccc1OCc1ccccc1)C(=O)OC1CC1.
What is the InChIKey of 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate?
The InChIKey is NEDODVATMXPRIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O6/c1-14(22)19(20(23)26-16-11-12-16)21(24)27-18-10-6-5-9-17(18)25-13-15-7-3-2-4-8-15/h2-10,16,19H,11-13H2,1H3.
What are the key properties of 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate?
1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate has a molecular weight of 368.38 g/mol, XLogP of 3.08, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-cyclopropyl 3-O-(2-phenylmethoxyphenyl) 2-acetylpropanedioate is sourced from PubChem (CID 174647558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).