C6H11NO — CID 174647776
6-methyl-3,4-dihydro-2H-pyran-4-amine (PubChem CID 174647776) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is 6-methyl-3,4-dihydro-2H-pyran-4-amine.
| Compound Name | 6-methyl-3,4-dihydro-2H-pyran-4-amine |
|---|---|
| PubChem CID | 174647776 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 6-methyl-3,4-dihydro-2H-pyran-4-amine |
| SMILES | CC1=CC(N)CCO1 |
| InChI | InChI=1S/C6H11NO/c1-5-4-6(7)2-3-8-5/h4,6H,2-3,7H2,1H3 |
| InChIKey | FFUXNKZLEJPNGY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |