About S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate
S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate (PubChem CID 174648085) has the molecular formula C8H10O3S2
and a molecular weight of 218.30 g/mol. Its IUPAC name is S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate.
Molecular Properties
| Compound Name | S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate |
| PubChem CID | 174648085 |
| Molecular Formula | C8H10O3S2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate |
| SMILES | CC=CC(=O)SOSC(=O)/C=C/C |
| InChI | InChI=1S/C8H10O3S2/c1-3-5-7(9)12-11-13-8(10)6-4-2/h3-6H,1-2H3/b5-3+,6-4? |
| InChIKey | BCTZGLJTKWXRBG-UHMKDZKBSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate?
The IUPAC name of S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate (CID 174648085) is S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate.
What is the SMILES notation for S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate?
The canonical SMILES for S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate is CC=CC(=O)SOSC(=O)/C=C/C.
What is the InChIKey of S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate?
The InChIKey is BCTZGLJTKWXRBG-UHMKDZKBSA-N. The full InChI is InChI=1S/C8H10O3S2/c1-3-5-7(9)12-11-13-8(10)6-4-2/h3-6H,1-2H3/b5-3+,6-4?.
What are the key properties of S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate?
S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate has a molecular weight of 218.30 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(E)-but-2-enoyl]sulfanyloxy but-2-enethioate is sourced from PubChem (CID 174648085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).