C24H38N2O4 — CID 174649188
dioctyl 7,8-diazabicyclo[4.2.0]octa-2,4,7-triene-1,6-dicarboxylate (PubChem CID 174649188) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is dioctyl 7,8-diazabicyclo[4.2.0]octa-2,4,7-triene-1,6-dicarboxylate.
| Compound Name | dioctyl 7,8-diazabicyclo[4.2.0]octa-2,4,7-triene-1,6-dicarboxylate |
|---|---|
| PubChem CID | 174649188 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | dioctyl 7,8-diazabicyclo[4.2.0]octa-2,4,7-triene-1,6-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)C12C=CC=CC1(C(=O)OCCCCCCCC)N=N2 |
| InChI | InChI=1S/C24H38N2O4/c1-3-5-7-9-11-15-19-29-21(27)23-17-13-14-18-24(23,26-25-23)22(28)30-20-16-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3 |
| InChIKey | MFYIWPWPJFMHGC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|