4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid

C9H8BrNO3 — CID 174655136

IUPAC4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid
SMILESO=C(O)C1Cc2c(Br)cccc2N1O
InChIInChI=1S/C9H8BrNO3/c10-6-2-1-3-7-5(6)4-8(9(12)13)11(7)14/h1-3,8,14H,4H2,(H,12,13)
InChIKeyDQMRFWDDQZLGNT-UHFFFAOYSA-N
MW258.07 g/mol
LogP1.65
Rot. Bonds1

About 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid

4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid (PubChem CID 174655136) has the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. Its IUPAC name is 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid.

Molecular Properties

Compound Name4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid
PubChem CID174655136
Molecular FormulaC9H8BrNO3
Molecular Weight258.07 g/mol
Exact Mass256.97
IUPAC Name4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid
SMILESO=C(O)C1Cc2c(Br)cccc2N1O
InChIInChI=1S/C9H8BrNO3/c10-6-2-1-3-7-5(6)4-8(9(12)13)11(7)14/h1-3,8,14H,4H2,(H,12,13)
InChIKeyDQMRFWDDQZLGNT-UHFFFAOYSA-N
XLogP1.65
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.07
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid?
The IUPAC name of 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid (CID 174655136) is 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid.
What is the SMILES notation for 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid?
The canonical SMILES for 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid is O=C(O)C1Cc2c(Br)cccc2N1O.
What is the InChIKey of 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid?
The InChIKey is DQMRFWDDQZLGNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO3/c10-6-2-1-3-7-5(6)4-8(9(12)13)11(7)14/h1-3,8,14H,4H2,(H,12,13).
What are the key properties of 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid?
4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid has a molecular weight of 258.07 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-hydroxy-2,3-dihydroindole-2-carboxylic acid is sourced from PubChem (CID 174655136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).