About 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate
2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate (PubChem CID 174655592) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate.
Molecular Properties
| Compound Name | 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate |
| PubChem CID | 174655592 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate |
| SMILES | CN(C(=O)OCCNC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H22N2O2/c1-14(2,3)15-10-11-18-13(17)16(4)12-8-6-5-7-9-12/h5-9,15H,10-11H2,1-4H3 |
| InChIKey | FZUMYFUUCYUJHT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate?
The IUPAC name of 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate (CID 174655592) is 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate.
What is the SMILES notation for 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate?
The canonical SMILES for 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate is CN(C(=O)OCCNC(C)(C)C)c1ccccc1.
What is the InChIKey of 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate?
The InChIKey is FZUMYFUUCYUJHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-14(2,3)15-10-11-18-13(17)16(4)12-8-6-5-7-9-12/h5-9,15H,10-11H2,1-4H3.
What are the key properties of 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate?
2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate has a molecular weight of 250.34 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)ethyl N-methyl-N-phenylcarbamate is sourced from PubChem (CID 174655592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).