C7H5Cl5F4O — CID 174656448
1,1,2,3,3-pentachloro-3-ethenoxyprop-1-ene;1,1,1,2-tetrafluoroethane (PubChem CID 174656448) has the molecular formula C7H5Cl5F4O and a molecular weight of 358.37 g/mol. Its IUPAC name is 1,1,2,3,3-pentachloro-3-ethenoxyprop-1-ene;1,1,1,2-tetrafluoroethane.
| Compound Name | 1,1,2,3,3-pentachloro-3-ethenoxyprop-1-ene;1,1,1,2-tetrafluoroethane |
|---|---|
| PubChem CID | 174656448 |
| Molecular Formula | C7H5Cl5F4O |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 355.87 |
| IUPAC Name | 1,1,2,3,3-pentachloro-3-ethenoxyprop-1-ene;1,1,1,2-tetrafluoroethane |
| SMILES | C=COC(Cl)(Cl)C(Cl)=C(Cl)Cl.FCC(F)(F)F |
| InChI | InChI=1S/C5H3Cl5O.C2H2F4/c1-2-11-5(9,10)3(6)4(7)8;3-1-2(4,5)6/h2H,1H2;1H2 |
| InChIKey | LWMQKJGZFRZHJS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|