C18H27BrFN3O3 — CID 174660426
[5-[2-(aminomethyl)-N-(1-bromo-2-oxoethyl)-3-fluoroanilino]-2,4,4-trimethylpentan-2-yl] carbamate (PubChem CID 174660426) has the molecular formula C18H27BrFN3O3 and a molecular weight of 432.33 g/mol. Its IUPAC name is [5-[2-(aminomethyl)-N-(1-bromo-2-oxoethyl)-3-fluoroanilino]-2,4,4-trimethylpentan-2-yl] carbamate.
| Compound Name | [5-[2-(aminomethyl)-N-(1-bromo-2-oxoethyl)-3-fluoroanilino]-2,4,4-trimethylpentan-2-yl] carbamate |
|---|---|
| PubChem CID | 174660426 |
| Molecular Formula | C18H27BrFN3O3 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [5-[2-(aminomethyl)-N-(1-bromo-2-oxoethyl)-3-fluoroanilino]-2,4,4-trimethylpentan-2-yl] carbamate |
| SMILES | CC(C)(CN(c1cccc(F)c1CN)C(Br)C=O)CC(C)(C)OC(N)=O |
| InChI | InChI=1S/C18H27BrFN3O3/c1-17(2,10-18(3,4)26-16(22)25)11-23(15(19)9-24)14-7-5-6-13(20)12(14)8-21/h5-7,9,15H,8,10-11,21H2,1-4H3,(H2,22,25) |
| InChIKey | LESAIDRMAWWVCP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|