About bis(3-oxopentyl) carbonate
bis(3-oxopentyl) carbonate (PubChem CID 174663018) has the molecular formula C11H18O5
and a molecular weight of 230.26 g/mol. Its IUPAC name is bis(3-oxopentyl) carbonate.
Molecular Properties
| Compound Name | bis(3-oxopentyl) carbonate |
| PubChem CID | 174663018 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | bis(3-oxopentyl) carbonate |
| SMILES | CCC(=O)CCOC(=O)OCCC(=O)CC |
| InChI | InChI=1S/C11H18O5/c1-3-9(12)5-7-15-11(14)16-8-6-10(13)4-2/h3-8H2,1-2H3 |
| InChIKey | QBULUKMKXBYJJC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(3-oxopentyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-oxopentyl) carbonate?
The IUPAC name of bis(3-oxopentyl) carbonate (CID 174663018) is bis(3-oxopentyl) carbonate.
What is the SMILES notation for bis(3-oxopentyl) carbonate?
The canonical SMILES for bis(3-oxopentyl) carbonate is CCC(=O)CCOC(=O)OCCC(=O)CC.
What is the InChIKey of bis(3-oxopentyl) carbonate?
The InChIKey is QBULUKMKXBYJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O5/c1-3-9(12)5-7-15-11(14)16-8-6-10(13)4-2/h3-8H2,1-2H3.
What are the key properties of bis(3-oxopentyl) carbonate?
bis(3-oxopentyl) carbonate has a molecular weight of 230.26 g/mol, XLogP of 1.88, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-oxopentyl) carbonate is sourced from PubChem (CID 174663018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).