C11H12ClN3O2 — CID 174663819
N-[1-(4-chloropyridine-2-carbonyl)pyrrolidin-2-yl]formamide (PubChem CID 174663819) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is N-[1-(4-chloropyridine-2-carbonyl)pyrrolidin-2-yl]formamide.
| Compound Name | N-[1-(4-chloropyridine-2-carbonyl)pyrrolidin-2-yl]formamide |
|---|---|
| PubChem CID | 174663819 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | N-[1-(4-chloropyridine-2-carbonyl)pyrrolidin-2-yl]formamide |
| SMILES | O=CNC1CCCN1C(=O)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C11H12ClN3O2/c12-8-3-4-13-9(6-8)11(17)15-5-1-2-10(15)14-7-16/h3-4,6-7,10H,1-2,5H2,(H,14,16) |
| InChIKey | QPJIPIQIMTZCLG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|