C19H19FN2O5 — CID 174663863
4-[[2-fluoro-5-(morpholin-4-ylmethyl)-3-pyridinyl]methyl]benzene-1,3-dicarboxylic acid (PubChem CID 174663863) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is 4-[[2-fluoro-5-(morpholin-4-ylmethyl)-3-pyridinyl]methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[2-fluoro-5-(morpholin-4-ylmethyl)-3-pyridinyl]methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174663863 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-[[2-fluoro-5-(morpholin-4-ylmethyl)-3-pyridinyl]methyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(Cc2cc(CN3CCOCC3)cnc2F)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H19FN2O5/c20-17-15(7-12(10-21-17)11-22-3-5-27-6-4-22)8-13-1-2-14(18(23)24)9-16(13)19(25)26/h1-2,7,9-10H,3-6,8,11H2,(H,23,24)(H,25,26) |
| InChIKey | MRUALQSSRAWHCQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|