C15H16N2O4S — CID 174665163
1-(2,6-diamino-3-methylsulfonyl-4-phenoxyphenyl)ethanone (PubChem CID 174665163) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-(2,6-diamino-3-methylsulfonyl-4-phenoxyphenyl)ethanone.
| Compound Name | 1-(2,6-diamino-3-methylsulfonyl-4-phenoxyphenyl)ethanone |
|---|---|
| PubChem CID | 174665163 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-(2,6-diamino-3-methylsulfonyl-4-phenoxyphenyl)ethanone |
| SMILES | CC(=O)c1c(N)cc(Oc2ccccc2)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C15H16N2O4S/c1-9(18)13-11(16)8-12(15(14(13)17)22(2,19)20)21-10-6-4-3-5-7-10/h3-8H,16-17H2,1-2H3 |
| InChIKey | AWBMZKQTNXOOCA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|