C23H17F2N5O2 — CID 174665851
2-[1-(6-aminopurin-9-yl)ethyl]-6-fluoro-3-(3-fluorophenyl)-4H-chromene-4-carbaldehyde (PubChem CID 174665851) has the molecular formula C23H17F2N5O2 and a molecular weight of 433.42 g/mol. Its IUPAC name is 2-[1-(6-aminopurin-9-yl)ethyl]-6-fluoro-3-(3-fluorophenyl)-4H-chromene-4-carbaldehyde.
| Compound Name | 2-[1-(6-aminopurin-9-yl)ethyl]-6-fluoro-3-(3-fluorophenyl)-4H-chromene-4-carbaldehyde |
|---|---|
| PubChem CID | 174665851 |
| Molecular Formula | C23H17F2N5O2 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-[1-(6-aminopurin-9-yl)ethyl]-6-fluoro-3-(3-fluorophenyl)-4H-chromene-4-carbaldehyde |
| SMILES | CC(C1=C(c2cccc(F)c2)C(C=O)c2cc(F)ccc2O1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C23H17F2N5O2/c1-12(30-11-29-20-22(26)27-10-28-23(20)30)21-19(13-3-2-4-14(24)7-13)17(9-31)16-8-15(25)5-6-18(16)32-21/h2-12,17H,1H3,(H2,26,27,28) |
| InChIKey | HEYJAEGQOINZHX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|