C22H17F2N5O — CID 141441318
9-[1-[6-fluoro-3-(2-fluorophenyl)-4H-chromen-2-yl]ethyl]purin-6-amine (PubChem CID 141441318) has the molecular formula C22H17F2N5O and a molecular weight of 405.41 g/mol. Its IUPAC name is 9-[1-[6-fluoro-3-(2-fluorophenyl)-4H-chromen-2-yl]ethyl]purin-6-amine.
| Compound Name | 9-[1-[6-fluoro-3-(2-fluorophenyl)-4H-chromen-2-yl]ethyl]purin-6-amine |
|---|---|
| PubChem CID | 141441318 |
| Molecular Formula | C22H17F2N5O |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 9-[1-[6-fluoro-3-(2-fluorophenyl)-4H-chromen-2-yl]ethyl]purin-6-amine |
| SMILES | CC(C1=C(c2ccccc2F)Cc2cc(F)ccc2O1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C22H17F2N5O/c1-12(29-11-28-19-21(25)26-10-27-22(19)29)20-16(15-4-2-3-5-17(15)24)9-13-8-14(23)6-7-18(13)30-20/h2-8,10-12H,9H2,1H3,(H2,25,26,27) |
| InChIKey | JZFNEJLHBLYNGE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |