C22H19N5O2 — CID 141402857
9-[(6-methoxy-3-phenyl-4H-chromen-2-yl)methyl]purin-6-amine (PubChem CID 141402857) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 9-[(6-methoxy-3-phenyl-4H-chromen-2-yl)methyl]purin-6-amine.
| Compound Name | 9-[(6-methoxy-3-phenyl-4H-chromen-2-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 141402857 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 9-[(6-methoxy-3-phenyl-4H-chromen-2-yl)methyl]purin-6-amine |
| SMILES | COc1ccc2c(c1)CC(c1ccccc1)=C(Cn1cnc3c(N)ncnc31)O2 |
| InChI | InChI=1S/C22H19N5O2/c1-28-16-7-8-18-15(9-16)10-17(14-5-3-2-4-6-14)19(29-18)11-27-13-26-20-21(23)24-12-25-22(20)27/h2-9,12-13H,10-11H2,1H3,(H2,23,24,25) |
| InChIKey | ZONYDHQVSPDWHB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |