C21H20N6O2 — CID 167981929
3-(6-aminopurin-9-yl)-N-methyl-N-(4-phenoxyphenyl)propanamide (PubChem CID 167981929) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-(6-aminopurin-9-yl)-N-methyl-N-(4-phenoxyphenyl)propanamide.
| Compound Name | 3-(6-aminopurin-9-yl)-N-methyl-N-(4-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 167981929 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-(6-aminopurin-9-yl)-N-methyl-N-(4-phenoxyphenyl)propanamide |
| SMILES | CN(C(=O)CCn1cnc2c(N)ncnc21)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N6O2/c1-26(15-7-9-17(10-8-15)29-16-5-3-2-4-6-16)18(28)11-12-27-14-25-19-20(22)23-13-24-21(19)27/h2-10,13-14H,11-12H2,1H3,(H2,22,23,24) |
| InChIKey | OHWPZPCHQDJYAX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |