C18H21N5O5 — CID 102282861
[2-hydroxy-3-(2-methoxyphenoxy)propyl] 3-(6-aminopurin-9-yl)propanoate (PubChem CID 102282861) has the molecular formula C18H21N5O5 and a molecular weight of 387.40 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methoxyphenoxy)propyl] 3-(6-aminopurin-9-yl)propanoate.
| Compound Name | [2-hydroxy-3-(2-methoxyphenoxy)propyl] 3-(6-aminopurin-9-yl)propanoate |
|---|---|
| PubChem CID | 102282861 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [2-hydroxy-3-(2-methoxyphenoxy)propyl] 3-(6-aminopurin-9-yl)propanoate |
| SMILES | COc1ccccc1OCC(O)COC(=O)CCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C18H21N5O5/c1-26-13-4-2-3-5-14(13)27-8-12(24)9-28-15(25)6-7-23-11-22-16-17(19)20-10-21-18(16)23/h2-5,10-12,24H,6-9H2,1H3,(H2,19,20,21) |
| InChIKey | FVBWWTHQVDOKBP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |