C19H29N5O2 — CID 145348802
anisole;methanol;9-[(2S)-2-methylpentyl]purin-6-amine (PubChem CID 145348802) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is anisole;methanol;9-[(2S)-2-methylpentyl]purin-6-amine.
| Compound Name | anisole;methanol;9-[(2S)-2-methylpentyl]purin-6-amine |
|---|---|
| PubChem CID | 145348802 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | anisole;methanol;9-[(2S)-2-methylpentyl]purin-6-amine |
| SMILES | CCC[C@H](C)Cn1cnc2c(N)ncnc21.CO.COc1ccccc1 |
| InChI | InChI=1S/C11H17N5.C7H8O.CH4O/c1-3-4-8(2)5-16-7-15-9-10(12)13-6-14-11(9)16;1-8-7-5-3-2-4-6-7;1-2/h6-8H,3-5H2,1-2H3,(H2,12,13,14);2-6H,1H3;2H,1H3/t8-;;/m0../s1 |
| InChIKey | KTDMMUPTXQOGIR-JZGIKJSDSA-N |
| XLogP | 3.15 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |