C20H18FN7O2S — CID 130337558
2-[[2-(6-aminopurin-9-yl)-1-anilinopropylidene]amino]-6-fluorobenzenesulfinic acid (PubChem CID 130337558) has the molecular formula C20H18FN7O2S and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-[[2-(6-aminopurin-9-yl)-1-anilinopropylidene]amino]-6-fluorobenzenesulfinic acid.
| Compound Name | 2-[[2-(6-aminopurin-9-yl)-1-anilinopropylidene]amino]-6-fluorobenzenesulfinic acid |
|---|---|
| PubChem CID | 130337558 |
| Molecular Formula | C20H18FN7O2S |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-[[2-(6-aminopurin-9-yl)-1-anilinopropylidene]amino]-6-fluorobenzenesulfinic acid |
| SMILES | CC(/C(=N/c1cccc(F)c1S(=O)O)Nc1ccccc1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H18FN7O2S/c1-12(28-11-25-16-18(22)23-10-24-20(16)28)19(26-13-6-3-2-4-7-13)27-15-9-5-8-14(21)17(15)31(29)30/h2-12H,1H3,(H,26,27)(H,29,30)(H2,22,23,24) |
| InChIKey | YJEAXDLWESBNMF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|