C15H13F3N4OS — CID 174667068
N-[4-[(1R)-1-(1-hydroxypyrazol-3-yl)ethyl]phenyl]-4-(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 174667068) has the molecular formula C15H13F3N4OS and a molecular weight of 354.36 g/mol. Its IUPAC name is N-[4-[(1R)-1-(1-hydroxypyrazol-3-yl)ethyl]phenyl]-4-(trifluoromethyl)-1,3-thiazol-2-amine.
| Compound Name | N-[4-[(1R)-1-(1-hydroxypyrazol-3-yl)ethyl]phenyl]-4-(trifluoromethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 174667068 |
| Molecular Formula | C15H13F3N4OS |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[4-[(1R)-1-(1-hydroxypyrazol-3-yl)ethyl]phenyl]-4-(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | C[C@H](c1ccc(Nc2nc(C(F)(F)F)cs2)cc1)c1ccn(O)n1 |
| InChI | InChI=1S/C15H13F3N4OS/c1-9(12-6-7-22(23)21-12)10-2-4-11(5-3-10)19-14-20-13(8-24-14)15(16,17)18/h2-9,23H,1H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | DOTLWMSQIFGRRR-SECBINFHSA-N |
| XLogP | 4.49 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|