C19H15F3N2O3S — CID 174667644
[4-[6-amino-5-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]phenyl]methanesulfinic acid (PubChem CID 174667644) has the molecular formula C19H15F3N2O3S and a molecular weight of 408.40 g/mol. Its IUPAC name is [4-[6-amino-5-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]phenyl]methanesulfinic acid.
| Compound Name | [4-[6-amino-5-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174667644 |
| Molecular Formula | C19H15F3N2O3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [4-[6-amino-5-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]phenyl]methanesulfinic acid |
| SMILES | Nc1ncc(-c2ccc(CS(=O)O)cc2)cc1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N2O3S/c20-19(21,22)27-16-3-1-2-14(8-16)17-9-15(10-24-18(17)23)13-6-4-12(5-7-13)11-28(25)26/h1-10H,11H2,(H2,23,24)(H,25,26) |
| InChIKey | KYTONESUVWEZSZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|