C12H13BrF3NO — CID 174668122
4-[3-(1-bromoethyl)-2,4,5-trifluorophenyl]morpholine (PubChem CID 174668122) has the molecular formula C12H13BrF3NO and a molecular weight of 324.14 g/mol. Its IUPAC name is 4-[3-(1-bromoethyl)-2,4,5-trifluorophenyl]morpholine.
| Compound Name | 4-[3-(1-bromoethyl)-2,4,5-trifluorophenyl]morpholine |
|---|---|
| PubChem CID | 174668122 |
| Molecular Formula | C12H13BrF3NO |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4-[3-(1-bromoethyl)-2,4,5-trifluorophenyl]morpholine |
| SMILES | CC(Br)c1c(F)c(F)cc(N2CCOCC2)c1F |
| InChI | InChI=1S/C12H13BrF3NO/c1-7(13)10-11(15)8(14)6-9(12(10)16)17-2-4-18-5-3-17/h6-7H,2-5H2,1H3 |
| InChIKey | CGJLWPPAWKYWOA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|