C18H29Cl3O3 — CID 174671316
1-butoxybutane;3,3,3-trichloro-2-methyl-1-phenylpropane-1,1-diol (PubChem CID 174671316) has the molecular formula C18H29Cl3O3 and a molecular weight of 399.79 g/mol. Its IUPAC name is 1-butoxybutane;3,3,3-trichloro-2-methyl-1-phenylpropane-1,1-diol.
| Compound Name | 1-butoxybutane;3,3,3-trichloro-2-methyl-1-phenylpropane-1,1-diol |
|---|---|
| PubChem CID | 174671316 |
| Molecular Formula | C18H29Cl3O3 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-butoxybutane;3,3,3-trichloro-2-methyl-1-phenylpropane-1,1-diol |
| SMILES | CC(C(Cl)(Cl)Cl)C(O)(O)c1ccccc1.CCCCOCCCC |
| InChI | InChI=1S/C10H11Cl3O2.C8H18O/c1-7(10(11,12)13)9(14,15)8-5-3-2-4-6-8;1-3-5-7-9-8-6-4-2/h2-7,14-15H,1H3;3-8H2,1-2H3 |
| InChIKey | QUIJCAYLAZSXPO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|