C23H33NO2 — CID 10882790
(2S)-3-butoxy-2-(butylamino)-1,1-diphenylpropan-1-ol (PubChem CID 10882790) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is (2S)-3-butoxy-2-(butylamino)-1,1-diphenylpropan-1-ol.
| Compound Name | (2S)-3-butoxy-2-(butylamino)-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 10882790 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (2S)-3-butoxy-2-(butylamino)-1,1-diphenylpropan-1-ol |
| SMILES | CCCCN[C@@H](COCCCC)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H33NO2/c1-3-5-17-24-22(19-26-18-6-4-2)23(25,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,22,24-25H,3-6,17-19H2,1-2H3/t22-/m0/s1 |
| InChIKey | HOFDLMYJUDIGJM-QFIPXVFZSA-N |
| XLogP | 4.50 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|