C21H21NO5S — CID 174671416
2-hydroxyimino-1-phenylethanone;6-methyl-1-phenylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 174671416) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-hydroxyimino-1-phenylethanone;6-methyl-1-phenylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 2-hydroxyimino-1-phenylethanone;6-methyl-1-phenylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 174671416 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-hydroxyimino-1-phenylethanone;6-methyl-1-phenylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CC1C=CC=CC1(c1ccccc1)S(=O)(=O)O.O=C(C=NO)c1ccccc1 |
| InChI | InChI=1S/C13H14O3S.C8H7NO2/c1-11-7-5-6-10-13(11,17(14,15)16)12-8-3-2-4-9-12;10-8(6-9-11)7-4-2-1-3-5-7/h2-11H,1H3,(H,14,15,16);1-6,11H |
| InChIKey | UKKDNVIOPDHMPX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|