C12H17F2P — CID 174672200
[3,5-difluoro-2-(2-methylpentan-2-yl)phenyl]phosphane (PubChem CID 174672200) has the molecular formula C12H17F2P and a molecular weight of 230.24 g/mol. Its IUPAC name is [3,5-difluoro-2-(2-methylpentan-2-yl)phenyl]phosphane.
| Compound Name | [3,5-difluoro-2-(2-methylpentan-2-yl)phenyl]phosphane |
|---|---|
| PubChem CID | 174672200 |
| Molecular Formula | C12H17F2P |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | [3,5-difluoro-2-(2-methylpentan-2-yl)phenyl]phosphane |
| SMILES | CCCC(C)(C)c1c(F)cc(F)cc1P |
| InChI | InChI=1S/C12H17F2P/c1-4-5-12(2,3)11-9(14)6-8(13)7-10(11)15/h6-7H,4-5,15H2,1-3H3 |
| InChIKey | RTEYLEWCICJFMH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|