C18H30O2 — CID 22146399
2,3-bis(2-methylpentan-2-yl)benzene-1,4-diol (PubChem CID 22146399) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2,3-bis(2-methylpentan-2-yl)benzene-1,4-diol.
| Compound Name | 2,3-bis(2-methylpentan-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 22146399 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2,3-bis(2-methylpentan-2-yl)benzene-1,4-diol |
| SMILES | CCCC(C)(C)c1c(O)ccc(O)c1C(C)(C)CCC |
| InChI | InChI=1S/C18H30O2/c1-7-11-17(3,4)15-13(19)9-10-14(20)16(15)18(5,6)12-8-2/h9-10,19-20H,7-8,11-12H2,1-6H3 |
| InChIKey | SUBOADIIPNHLEJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|