C19H29F3O — CID 162115908
2-(2-ethoxyundecan-2-yl)-1,3,5-trifluorobenzene (PubChem CID 162115908) has the molecular formula C19H29F3O and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(2-ethoxyundecan-2-yl)-1,3,5-trifluorobenzene.
| Compound Name | 2-(2-ethoxyundecan-2-yl)-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 162115908 |
| Molecular Formula | C19H29F3O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 2-(2-ethoxyundecan-2-yl)-1,3,5-trifluorobenzene |
| SMILES | CCCCCCCCCC(C)(OCC)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C19H29F3O/c1-4-6-7-8-9-10-11-12-19(3,23-5-2)18-16(21)13-15(20)14-17(18)22/h13-14H,4-12H2,1-3H3 |
| InChIKey | ZGTIKCUKTMDFLY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|