C21H26O6 — CID 174676519
phenyl-[4-(1,2,3,8-tetrahydroxyoctoxy)phenyl]methanone (PubChem CID 174676519) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is phenyl-[4-(1,2,3,8-tetrahydroxyoctoxy)phenyl]methanone.
| Compound Name | phenyl-[4-(1,2,3,8-tetrahydroxyoctoxy)phenyl]methanone |
|---|---|
| PubChem CID | 174676519 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | phenyl-[4-(1,2,3,8-tetrahydroxyoctoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1)c1ccc(OC(O)C(O)C(O)CCCCCO)cc1 |
| InChI | InChI=1S/C21H26O6/c22-14-6-2-5-9-18(23)20(25)21(26)27-17-12-10-16(11-13-17)19(24)15-7-3-1-4-8-15/h1,3-4,7-8,10-13,18,20-23,25-26H,2,5-6,9,14H2 |
| InChIKey | BUBKVYURVQUPRN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|