C17H23N5O — CID 174677446
6-(3-methyl-4-propoxybutanimidoyl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 174677446) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 6-(3-methyl-4-propoxybutanimidoyl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(3-methyl-4-propoxybutanimidoyl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 174677446 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 6-(3-methyl-4-propoxybutanimidoyl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | [H]/N=C(\CC(C)COCCC)c1nnc(N)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H23N5O/c1-3-9-23-11-12(2)10-14(18)16-15(20-17(19)22-21-16)13-7-5-4-6-8-13/h4-8,12,18H,3,9-11H2,1-2H3,(H2,19,20,22)/b18-14+ |
| InChIKey | OVPORQHSKTVKAG-NBVRZTHBSA-N |
| XLogP | 2.94 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|